C21H20F2N2O3S — CID 172864047
5-[2-[2-(2,4-difluoroanilino)ethylsulfonyl]phenyl]-1,3-dimethylpyridin-2-one (PubChem CID 172864047) has the molecular formula C21H20F2N2O3S and a molecular weight of 418.47 g/mol. Its IUPAC name is 5-[2-[2-(2,4-difluoroanilino)ethylsulfonyl]phenyl]-1,3-dimethylpyridin-2-one.
| Compound Name | 5-[2-[2-(2,4-difluoroanilino)ethylsulfonyl]phenyl]-1,3-dimethylpyridin-2-one |
|---|---|
| PubChem CID | 172864047 |
| Molecular Formula | C21H20F2N2O3S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 5-[2-[2-(2,4-difluoroanilino)ethylsulfonyl]phenyl]-1,3-dimethylpyridin-2-one |
| SMILES | Cc1cc(-c2ccccc2S(=O)(=O)CCNc2ccc(F)cc2F)cn(C)c1=O |
| InChI | InChI=1S/C21H20F2N2O3S/c1-14-11-15(13-25(2)21(14)26)17-5-3-4-6-20(17)29(27,28)10-9-24-19-8-7-16(22)12-18(19)23/h3-8,11-13,24H,9-10H2,1-2H3 |
| InChIKey | ZSZLGJUIEUCSRV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |