About potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide
potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide (PubChem CID 172865916) has the molecular formula C12H13Br2KO3
and a molecular weight of 404.14 g/mol. Its IUPAC name is potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide.
Molecular Properties
| Compound Name | potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide |
| PubChem CID | 172865916 |
| Molecular Formula | C12H13Br2KO3 |
| Molecular Weight | 404.14 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide |
| SMILES | CC(C)(C)OC(=O)c1cc(Br)cc(C=O)c1.[Br-].[K+] |
| InChI | InChI=1S/C12H13BrO3.BrH.K/c1-12(2,3)16-11(15)9-4-8(7-14)5-10(13)6-9;;/h4-7H,1-3H3;1H;/q;;+1/p-1 |
| InChIKey | ZZJGKRCSMXSXNN-UHFFFAOYSA-M |
| XLogP | -2.78 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.14 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide?
The IUPAC name of potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide (CID 172865916) is potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide.
What is the SMILES notation for potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide?
The canonical SMILES for potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide is CC(C)(C)OC(=O)c1cc(Br)cc(C=O)c1.[Br-].[K+].
What is the InChIKey of potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide?
The InChIKey is ZZJGKRCSMXSXNN-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H13BrO3.BrH.K/c1-12(2,3)16-11(15)9-4-8(7-14)5-10(13)6-9;;/h4-7H,1-3H3;1H;/q;;+1/p-1.
What are the key properties of potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide?
potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide has a molecular weight of 404.14 g/mol, XLogP of -2.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;tert-butyl 3-bromo-5-formylbenzoate;bromide is sourced from PubChem (CID 172865916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).