C15H14BrF6NO3 — CID 130350024
tert-butyl N-[2-(3-bromo-5-formylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate (PubChem CID 130350024) has the molecular formula C15H14BrF6NO3 and a molecular weight of 450.17 g/mol. Its IUPAC name is tert-butyl N-[2-(3-bromo-5-formylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[2-(3-bromo-5-formylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
|---|---|
| PubChem CID | 130350024 |
| Molecular Formula | C15H14BrF6NO3 |
| Molecular Weight | 450.17 g/mol |
| Exact Mass | 449.01 |
| IUPAC Name | tert-butyl N-[2-(3-bromo-5-formylphenyl)-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1cc(Br)cc(C=O)c1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H14BrF6NO3/c1-12(2,3)26-11(25)23-13(14(17,18)19,15(20,21)22)9-4-8(7-24)5-10(16)6-9/h4-7H,1-3H3,(H,23,25) |
| InChIKey | XRIPBLWCSPYHKG-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.17 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|