C26H26O6 — CID 172869663
1-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]-2-(4-methoxyphenyl)ethane-1,2-dione (PubChem CID 172869663) has the molecular formula C26H26O6 and a molecular weight of 434.49 g/mol. Its IUPAC name is 1-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]-2-(4-methoxyphenyl)ethane-1,2-dione.
| Compound Name | 1-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]-2-(4-methoxyphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 172869663 |
| Molecular Formula | C26H26O6 |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 1-[4,5-dimethoxy-2-[2-(4-methoxyphenyl)ethyl]phenyl]-2-(4-methoxyphenyl)ethane-1,2-dione |
| SMILES | COc1ccc(CCc2cc(OC)c(OC)cc2C(=O)C(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H26O6/c1-29-20-11-6-17(7-12-20)5-8-19-15-23(31-3)24(32-4)16-22(19)26(28)25(27)18-9-13-21(30-2)14-10-18/h6-7,9-16H,5,8H2,1-4H3 |
| InChIKey | QGVKBGGTIGDTPT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|