C27H36O12 — CID 172869858
(1S,3R,4R,5R)-1,3-dihydroxy-4,5-bis[(3,4,5-trimethoxyphenyl)methoxy]cyclohexane-1-carboxylic acid (PubChem CID 172869858) has the molecular formula C27H36O12 and a molecular weight of 552.57 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,3-dihydroxy-4,5-bis[(3,4,5-trimethoxyphenyl)methoxy]cyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-1,3-dihydroxy-4,5-bis[(3,4,5-trimethoxyphenyl)methoxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 172869858 |
| Molecular Formula | C27H36O12 |
| Molecular Weight | 552.57 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | (1S,3R,4R,5R)-1,3-dihydroxy-4,5-bis[(3,4,5-trimethoxyphenyl)methoxy]cyclohexane-1-carboxylic acid |
| SMILES | COc1cc(CO[C@@H]2[C@H](O)C[C@@](O)(C(=O)O)C[C@H]2OCc2cc(OC)c(OC)c(OC)c2)cc(OC)c1OC |
| InChI | InChI=1S/C27H36O12/c1-32-18-7-15(8-19(33-2)24(18)36-5)13-38-22-12-27(31,26(29)30)11-17(28)23(22)39-14-16-9-20(34-3)25(37-6)21(10-16)35-4/h7-10,17,22-23,28,31H,11-14H2,1-6H3,(H,29,30)/t17-,22-,23-,27+/m1/s1 |
| InChIKey | QOSGTHJAYKYYQC-UOWZRNCZSA-N |
| XLogP | 2.18 |
| TPSA | 151.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |