C20H13Cl2N3OS — CID 172876429
N-(2,4-dichlorophenyl)-4-(3-thiophen-2-ylpyrazol-1-yl)benzamide (PubChem CID 172876429) has the molecular formula C20H13Cl2N3OS and a molecular weight of 414.32 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-4-(3-thiophen-2-ylpyrazol-1-yl)benzamide.
| Compound Name | N-(2,4-dichlorophenyl)-4-(3-thiophen-2-ylpyrazol-1-yl)benzamide |
|---|---|
| PubChem CID | 172876429 |
| Molecular Formula | C20H13Cl2N3OS |
| Molecular Weight | 414.32 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | N-(2,4-dichlorophenyl)-4-(3-thiophen-2-ylpyrazol-1-yl)benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1Cl)c1ccc(-n2ccc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C20H13Cl2N3OS/c21-14-5-8-17(16(22)12-14)23-20(26)13-3-6-15(7-4-13)25-10-9-18(24-25)19-2-1-11-27-19/h1-12H,(H,23,26) |
| InChIKey | IQWHBQNATDITRN-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.32 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |