C16H13Cl2N3OS — CID 121139893
2,5-dichloro-N-[2-(3-thiophen-2-ylpyrazol-1-yl)ethyl]benzamide (PubChem CID 121139893) has the molecular formula C16H13Cl2N3OS and a molecular weight of 366.27 g/mol. Its IUPAC name is 2,5-dichloro-N-[2-(3-thiophen-2-ylpyrazol-1-yl)ethyl]benzamide.
| Compound Name | 2,5-dichloro-N-[2-(3-thiophen-2-ylpyrazol-1-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 121139893 |
| Molecular Formula | C16H13Cl2N3OS |
| Molecular Weight | 366.27 g/mol |
| Exact Mass | 365.02 |
| IUPAC Name | 2,5-dichloro-N-[2-(3-thiophen-2-ylpyrazol-1-yl)ethyl]benzamide |
| SMILES | O=C(NCCn1ccc(-c2cccs2)n1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2N3OS/c17-11-3-4-13(18)12(10-11)16(22)19-6-8-21-7-5-14(20-21)15-2-1-9-23-15/h1-5,7,9-10H,6,8H2,(H,19,22) |
| InChIKey | ZCMOIWPRKGSQDO-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |