About 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride
1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride (PubChem CID 172876616) has the molecular formula C17H19ClF3N
and a molecular weight of 329.79 g/mol. Its IUPAC name is 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride |
| PubChem CID | 172876616 |
| Molecular Formula | C17H19ClF3N |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride |
| SMILES | CNCc1c(C)cc(-c2ccccc2C(F)(F)F)cc1C.Cl |
| InChI | InChI=1S/C17H18F3N.ClH/c1-11-8-13(9-12(2)15(11)10-21-3)14-6-4-5-7-16(14)17(18,19)20;/h4-9,21H,10H2,1-3H3;1H |
| InChIKey | AURBIKUOVSPAQI-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride?
The IUPAC name of 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride (CID 172876616) is 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride.
What is the SMILES notation for 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride?
The canonical SMILES for 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride is CNCc1c(C)cc(-c2ccccc2C(F)(F)F)cc1C.Cl.
What is the InChIKey of 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride?
The InChIKey is AURBIKUOVSPAQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18F3N.ClH/c1-11-8-13(9-12(2)15(11)10-21-3)14-6-4-5-7-16(14)17(18,19)20;/h4-9,21H,10H2,1-3H3;1H.
What are the key properties of 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride?
1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride has a molecular weight of 329.79 g/mol, XLogP of 5.13, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,6-dimethyl-4-[2-(trifluoromethyl)phenyl]phenyl]-N-methylmethanamine;hydrochloride is sourced from PubChem (CID 172876616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).