About [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride
[4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride (PubChem CID 172876719) has the molecular formula C15H17ClFN
and a molecular weight of 265.76 g/mol. Its IUPAC name is [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride.
Molecular Properties
| Compound Name | [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride |
| PubChem CID | 172876719 |
| Molecular Formula | C15H17ClFN |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride |
| SMILES | Cc1cc(-c2ccccc2F)cc(C)c1CN.Cl |
| InChI | InChI=1S/C15H16FN.ClH/c1-10-7-12(8-11(2)14(10)9-17)13-5-3-4-6-15(13)16;/h3-8H,9,17H2,1-2H3;1H |
| InChIKey | DMKTUGNOCPYZBZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride?
The IUPAC name of [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride (CID 172876719) is [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride.
What is the SMILES notation for [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride?
The canonical SMILES for [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride is Cc1cc(-c2ccccc2F)cc(C)c1CN.Cl.
What is the InChIKey of [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride?
The InChIKey is DMKTUGNOCPYZBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16FN.ClH/c1-10-7-12(8-11(2)14(10)9-17)13-5-3-4-6-15(13)16;/h3-8H,9,17H2,1-2H3;1H.
What are the key properties of [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride?
[4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride has a molecular weight of 265.76 g/mol, XLogP of 3.99, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(2-fluorophenyl)-2,6-dimethylphenyl]methanamine;hydrochloride is sourced from PubChem (CID 172876719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).