C19H18N2O2S — CID 172877101
2-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-1,2-benzothiazol-3-one (PubChem CID 172877101) has the molecular formula C19H18N2O2S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-1,2-benzothiazol-3-one.
| Compound Name | 2-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 172877101 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 2-[[4-(pyrrolidine-1-carbonyl)phenyl]methyl]-1,2-benzothiazol-3-one |
| SMILES | O=C(c1ccc(Cn2sc3ccccc3c2=O)cc1)N1CCCC1 |
| InChI | InChI=1S/C19H18N2O2S/c22-18(20-11-3-4-12-20)15-9-7-14(8-10-15)13-21-19(23)16-5-1-2-6-17(16)24-21/h1-2,5-10H,3-4,11-13H2 |
| InChIKey | GCVUOHDCMGAYEN-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |