C26H43N3O2 — CID 172879335
2-aminobenzoate;1,3-dioctylimidazol-1-ium (PubChem CID 172879335) has the molecular formula C26H43N3O2 and a molecular weight of 429.65 g/mol. Its IUPAC name is 2-aminobenzoate;1,3-dioctylimidazol-1-ium.
| Compound Name | 2-aminobenzoate;1,3-dioctylimidazol-1-ium |
|---|---|
| PubChem CID | 172879335 |
| Molecular Formula | C26H43N3O2 |
| Molecular Weight | 429.65 g/mol |
| Exact Mass | 429.34 |
| IUPAC Name | 2-aminobenzoate;1,3-dioctylimidazol-1-ium |
| SMILES | CCCCCCCCn1cc[n+](CCCCCCCC)c1.Nc1ccccc1C(=O)[O-] |
| InChI | InChI=1S/C19H37N2.C7H7NO2/c1-3-5-7-9-11-13-15-20-17-18-21(19-20)16-14-12-10-8-6-4-2;8-6-4-2-1-3-5(6)7(9)10/h17-19H,3-16H2,1-2H3;1-4H,8H2,(H,9,10)/q+1;/p-1 |
| InChIKey | SUPUWAUDYGJHFO-UHFFFAOYSA-M |
| XLogP | 5.13 |
| TPSA | 74.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.65 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|