C28H20ClN3O2S — CID 172880280
3-[2-[5-(4-chlorophenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 172880280) has the molecular formula C28H20ClN3O2S and a molecular weight of 498.01 g/mol. Its IUPAC name is 3-[2-[5-(4-chlorophenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[5-(4-chlorophenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 172880280 |
| Molecular Formula | C28H20ClN3O2S |
| Molecular Weight | 498.01 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | 3-[2-[5-(4-chlorophenyl)-3-(4-methylphenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | Cc1ccc(C2CC(c3ccc(Cl)cc3)=NN2c2nc(-c3cc4ccccc4oc3=O)cs2)cc1 |
| InChI | InChI=1S/C28H20ClN3O2S/c1-17-6-8-19(9-7-17)25-15-23(18-10-12-21(29)13-11-18)31-32(25)28-30-24(16-35-28)22-14-20-4-2-3-5-26(20)34-27(22)33/h2-14,16,25H,15H2,1H3 |
| InChIKey | GIAUESXIWTULSX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.01 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|