C27H17Cl2N3O2S — CID 172871670
3-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one (PubChem CID 172871670) has the molecular formula C27H17Cl2N3O2S and a molecular weight of 518.43 g/mol. Its IUPAC name is 3-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one.
| Compound Name | 3-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
|---|---|
| PubChem CID | 172871670 |
| Molecular Formula | C27H17Cl2N3O2S |
| Molecular Weight | 518.43 g/mol |
| Exact Mass | 517.04 |
| IUPAC Name | 3-[2-[3,5-bis(4-chlorophenyl)-3,4-dihydropyrazol-2-yl]-1,3-thiazol-4-yl]chromen-2-one |
| SMILES | O=c1oc2ccccc2cc1-c1csc(N2N=C(c3ccc(Cl)cc3)CC2c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C27H17Cl2N3O2S/c28-19-9-5-16(6-10-19)22-14-24(17-7-11-20(29)12-8-17)32(31-22)27-30-23(15-35-27)21-13-18-3-1-2-4-25(18)34-26(21)33/h1-13,15,24H,14H2 |
| InChIKey | DWQZZQTYDLXPOV-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 58.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.43 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|