C24H18IN3S — CID 2840664
2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-4-(4-iodophenyl)-1,3-thiazole (PubChem CID 2840664) has the molecular formula C24H18IN3S and a molecular weight of 507.40 g/mol. Its IUPAC name is 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-4-(4-iodophenyl)-1,3-thiazole.
| Compound Name | 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-4-(4-iodophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 2840664 |
| Molecular Formula | C24H18IN3S |
| Molecular Weight | 507.40 g/mol |
| Exact Mass | 507.03 |
| IUPAC Name | 2-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)-4-(4-iodophenyl)-1,3-thiazole |
| SMILES | Ic1ccc(-c2csc(N3N=C(c4ccccc4)CC3c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C24H18IN3S/c25-20-13-11-18(12-14-20)22-16-29-24(26-22)28-23(19-9-5-2-6-10-19)15-21(27-28)17-7-3-1-4-8-17/h1-14,16,23H,15H2 |
| InChIKey | PERIQAWTDJHKLS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|