C30H23N3OS — CID 136961371
4-[3-phenyl-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 136961371) has the molecular formula C30H23N3OS and a molecular weight of 473.60 g/mol. Its IUPAC name is 4-[3-phenyl-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 4-[3-phenyl-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 136961371 |
| Molecular Formula | C30H23N3OS |
| Molecular Weight | 473.60 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 4-[3-phenyl-2-[4-(4-phenylphenyl)-1,3-thiazol-2-yl]-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | Oc1ccc(C2=NN(c3nc(-c4ccc(-c5ccccc5)cc4)cs3)C(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H23N3OS/c34-26-17-15-23(16-18-26)27-19-29(25-9-5-2-6-10-25)33(32-27)30-31-28(20-35-30)24-13-11-22(12-14-24)21-7-3-1-4-8-21/h1-18,20,29,34H,19H2 |
| InChIKey | TZVIUJBJRLXEFH-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.60 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'} |
|---|