C31H24N4 — CID 92844911
2-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-4,6-diphenylpyrimidine (PubChem CID 92844911) has the molecular formula C31H24N4 and a molecular weight of 452.56 g/mol. Its IUPAC name is 2-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-4,6-diphenylpyrimidine.
| Compound Name | 2-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-4,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 92844911 |
| Molecular Formula | C31H24N4 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 2-[(3S)-3,5-diphenyl-3,4-dihydropyrazol-2-yl]-4,6-diphenylpyrimidine |
| SMILES | c1ccc(C2=NN(c3nc(-c4ccccc4)cc(-c4ccccc4)n3)[C@H](c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C31H24N4/c1-5-13-23(14-6-1)27-21-28(24-15-7-2-8-16-24)33-31(32-27)35-30(26-19-11-4-12-20-26)22-29(34-35)25-17-9-3-10-18-25/h1-21,30H,22H2/t30-/m0/s1 |
| InChIKey | URGQMHSJVSYSGM-PMERELPUSA-N |
| XLogP | 7.17 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |