About 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile
3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile (PubChem CID 172880808) has the molecular formula C15H18N6S
and a molecular weight of 314.42 g/mol. Its IUPAC name is 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile.
Molecular Properties
| Compound Name | 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| PubChem CID | 172880808 |
| Molecular Formula | C15H18N6S |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile |
| SMILES | Cc1nc(CN2CCN(c3nccnc3C#N)CC2)sc1C |
| InChI | InChI=1S/C15H18N6S/c1-11-12(2)22-14(19-11)10-20-5-7-21(8-6-20)15-13(9-16)17-3-4-18-15/h3-4H,5-8,10H2,1-2H3 |
| InChIKey | DADMGPMAKYFEBO-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 68.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The IUPAC name of 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile (CID 172880808) is 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile.
What is the SMILES notation for 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The canonical SMILES for 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile is Cc1nc(CN2CCN(c3nccnc3C#N)CC2)sc1C.
What is the InChIKey of 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
The InChIKey is DADMGPMAKYFEBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18N6S/c1-11-12(2)22-14(19-11)10-20-5-7-21(8-6-20)15-13(9-16)17-3-4-18-15/h3-4H,5-8,10H2,1-2H3.
What are the key properties of 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile?
3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile has a molecular weight of 314.42 g/mol, XLogP of 1.74, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-[(4,5-dimethyl-1,3-thiazol-2-yl)methyl]piperazin-1-yl]pyrazine-2-carbonitrile is sourced from PubChem (CID 172880808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).