C19H23FN6 — CID 172881442
N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-cyclopropylpyrimidin-4-amine (PubChem CID 172881442) has the molecular formula C19H23FN6 and a molecular weight of 354.43 g/mol. Its IUPAC name is N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-cyclopropylpyrimidin-4-amine.
| Compound Name | N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-cyclopropylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172881442 |
| Molecular Formula | C19H23FN6 |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | N-[1-(6-cyclobutyl-5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-cyclopropylpyrimidin-4-amine |
| SMILES | Fc1c(C2CCC2)ncnc1N1CCC(N(c2ccncn2)C2CC2)C1 |
| InChI | InChI=1S/C19H23FN6/c20-17-18(13-2-1-3-13)23-12-24-19(17)25-9-7-15(10-25)26(14-4-5-14)16-6-8-21-11-22-16/h6,8,11-15H,1-5,7,9-10H2 |
| InChIKey | BVQMNUWHVPMLPR-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |