C18H26N6 — CID 56873336
4-cyclobutyl-6-methyl-2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]pyrimidine (PubChem CID 56873336) has the molecular formula C18H26N6 and a molecular weight of 326.45 g/mol. Its IUPAC name is 4-cyclobutyl-6-methyl-2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]pyrimidine.
| Compound Name | 4-cyclobutyl-6-methyl-2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 56873336 |
| Molecular Formula | C18H26N6 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 4-cyclobutyl-6-methyl-2-[4-[(1-methylimidazol-2-yl)methyl]piperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(C2CCC2)nc(N2CCN(Cc3nccn3C)CC2)n1 |
| InChI | InChI=1S/C18H26N6/c1-14-12-16(15-4-3-5-15)21-18(20-14)24-10-8-23(9-11-24)13-17-19-6-7-22(17)2/h6-7,12,15H,3-5,8-11,13H2,1-2H3 |
| InChIKey | NAUGGLDORMZRLL-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |