About 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile
5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile (PubChem CID 172881446) has the molecular formula C19H18N4O2
and a molecular weight of 334.38 g/mol. Its IUPAC name is 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile |
| PubChem CID | 172881446 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(N2CCOC(C(=O)N3CCc4ccccc43)C2)cn1 |
| InChI | InChI=1S/C19H18N4O2/c20-11-15-5-6-16(12-21-15)22-9-10-25-18(13-22)19(24)23-8-7-14-3-1-2-4-17(14)23/h1-6,12,18H,7-10,13H2 |
| InChIKey | KIYGDZKVANKYJR-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 69.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile?
The IUPAC name of 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile (CID 172881446) is 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile?
The canonical SMILES for 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile is N#Cc1ccc(N2CCOC(C(=O)N3CCc4ccccc43)C2)cn1.
What is the InChIKey of 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile?
The InChIKey is KIYGDZKVANKYJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N4O2/c20-11-15-5-6-16(12-21-15)22-9-10-25-18(13-22)19(24)23-8-7-14-3-1-2-4-17(14)23/h1-6,12,18H,7-10,13H2.
What are the key properties of 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile?
5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile has a molecular weight of 334.38 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[2-(2,3-dihydroindole-1-carbonyl)morpholin-4-yl]pyridine-2-carbonitrile is sourced from PubChem (CID 172881446), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).