C16H17NO4 — CID 172882133
3-(2,6-dimethylmorpholine-4-carbonyl)isochromen-1-one (PubChem CID 172882133) has the molecular formula C16H17NO4 and a molecular weight of 287.31 g/mol. Its IUPAC name is 3-(2,6-dimethylmorpholine-4-carbonyl)isochromen-1-one.
| Compound Name | 3-(2,6-dimethylmorpholine-4-carbonyl)isochromen-1-one |
|---|---|
| PubChem CID | 172882133 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | 3-(2,6-dimethylmorpholine-4-carbonyl)isochromen-1-one |
| SMILES | CC1CN(C(=O)c2cc3ccccc3c(=O)o2)CC(C)O1 |
| InChI | InChI=1S/C16H17NO4/c1-10-8-17(9-11(2)20-10)15(18)14-7-12-5-3-4-6-13(12)16(19)21-14/h3-7,10-11H,8-9H2,1-2H3 |
| InChIKey | ZBICOYAQZDGNSE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |