About ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride
ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride (PubChem CID 172883005) has the molecular formula C17H19BrClNO2
and a molecular weight of 384.70 g/mol. Its IUPAC name is ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride |
| PubChem CID | 172883005 |
| Molecular Formula | C17H19BrClNO2 |
| Molecular Weight | 384.70 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride |
| SMILES | CCOC(=O)c1ccc([C@H](C)Nc2ccc(Br)cc2)cc1.Cl |
| InChI | InChI=1S/C17H18BrNO2.ClH/c1-3-21-17(20)14-6-4-13(5-7-14)12(2)19-16-10-8-15(18)9-11-16;/h4-12,19H,3H2,1-2H3;1H/t12-;/m0./s1 |
| InChIKey | MLFDPFUDUPWWNV-YDALLXLXSA-N |
| XLogP | 5.22 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.70 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride?
The IUPAC name of ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride (CID 172883005) is ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride.
What is the SMILES notation for ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride?
The canonical SMILES for ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride is CCOC(=O)c1ccc([C@H](C)Nc2ccc(Br)cc2)cc1.Cl.
What is the InChIKey of ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride?
The InChIKey is MLFDPFUDUPWWNV-YDALLXLXSA-N. The full InChI is InChI=1S/C17H18BrNO2.ClH/c1-3-21-17(20)14-6-4-13(5-7-14)12(2)19-16-10-8-15(18)9-11-16;/h4-12,19H,3H2,1-2H3;1H/t12-;/m0./s1.
What are the key properties of ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride?
ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride has a molecular weight of 384.70 g/mol, XLogP of 5.22, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[(1S)-1-(4-bromoanilino)ethyl]benzoate;hydrochloride is sourced from PubChem (CID 172883005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).