C11H14IN5O2 — CID 172886347
N-[(E)-1-(3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide (PubChem CID 172886347) has the molecular formula C11H14IN5O2 and a molecular weight of 375.17 g/mol. Its IUPAC name is N-[(E)-1-(3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide.
| Compound Name | N-[(E)-1-(3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
|---|---|
| PubChem CID | 172886347 |
| Molecular Formula | C11H14IN5O2 |
| Molecular Weight | 375.17 g/mol |
| Exact Mass | 375.02 |
| IUPAC Name | N-[(E)-1-(3-nitrophenyl)ethylideneamino]-4,5-dihydro-1H-imidazol-2-amine;hydroiodide |
| SMILES | C/C(=N\NC1=NCCN1)c1cccc([N+](=O)[O-])c1.I |
| InChI | InChI=1S/C11H13N5O2.HI/c1-8(14-15-11-12-5-6-13-11)9-3-2-4-10(7-9)16(17)18;/h2-4,7H,5-6H2,1H3,(H2,12,13,15);1H/b14-8+; |
| InChIKey | LFUIMENEKYQMCY-XHIXCECLSA-N |
| XLogP | 1.49 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|