C23H26ClN3O3 — CID 172887268
2-(2-chlorophenoxy)-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]propanamide (PubChem CID 172887268) has the molecular formula C23H26ClN3O3 and a molecular weight of 427.93 g/mol. Its IUPAC name is 2-(2-chlorophenoxy)-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]propanamide.
| Compound Name | 2-(2-chlorophenoxy)-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 172887268 |
| Molecular Formula | C23H26ClN3O3 |
| Molecular Weight | 427.93 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 2-(2-chlorophenoxy)-N-[[4-(4-prop-2-enoylpiperazin-1-yl)phenyl]methyl]propanamide |
| SMILES | C=CC(=O)N1CCN(c2ccc(CNC(=O)C(C)Oc3ccccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C23H26ClN3O3/c1-3-22(28)27-14-12-26(13-15-27)19-10-8-18(9-11-19)16-25-23(29)17(2)30-21-7-5-4-6-20(21)24/h3-11,17H,1,12-16H2,2H3,(H,25,29) |
| InChIKey | BWGHDJHTVCUMND-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.93 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|