C18H19ClN2O4S2 — CID 172887363
5-chloro-N-[4-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]thiophene-2-sulfonamide (PubChem CID 172887363) has the molecular formula C18H19ClN2O4S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 5-chloro-N-[4-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[4-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 172887363 |
| Molecular Formula | C18H19ClN2O4S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 5-chloro-N-[4-(1-prop-2-enoylpiperidin-4-yl)oxyphenyl]thiophene-2-sulfonamide |
| SMILES | C=CC(=O)N1CCC(Oc2ccc(NS(=O)(=O)c3ccc(Cl)s3)cc2)CC1 |
| InChI | InChI=1S/C18H19ClN2O4S2/c1-2-17(22)21-11-9-15(10-12-21)25-14-5-3-13(4-6-14)20-27(23,24)18-8-7-16(19)26-18/h2-8,15,20H,1,9-12H2 |
| InChIKey | ARGPDSQAUAGNSP-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|