C17H21F2N3O3 — CID 172887608
N-[4,4-difluoro-1-(5-propan-2-yloxypyridine-3-carbonyl)piperidin-3-yl]prop-2-enamide (PubChem CID 172887608) has the molecular formula C17H21F2N3O3 and a molecular weight of 353.37 g/mol. Its IUPAC name is N-[4,4-difluoro-1-(5-propan-2-yloxypyridine-3-carbonyl)piperidin-3-yl]prop-2-enamide.
| Compound Name | N-[4,4-difluoro-1-(5-propan-2-yloxypyridine-3-carbonyl)piperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 172887608 |
| Molecular Formula | C17H21F2N3O3 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[4,4-difluoro-1-(5-propan-2-yloxypyridine-3-carbonyl)piperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CN(C(=O)c2cncc(OC(C)C)c2)CCC1(F)F |
| InChI | InChI=1S/C17H21F2N3O3/c1-4-15(23)21-14-10-22(6-5-17(14,18)19)16(24)12-7-13(9-20-8-12)25-11(2)3/h4,7-9,11,14H,1,5-6,10H2,2-3H3,(H,21,23) |
| InChIKey | AEZMIAMWFLKHLA-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|