C16H16ClF3N2O2 — CID 172887592
N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]-4,4-difluoropiperidin-3-yl]prop-2-enamide (PubChem CID 172887592) has the molecular formula C16H16ClF3N2O2 and a molecular weight of 360.76 g/mol. Its IUPAC name is N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]-4,4-difluoropiperidin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]-4,4-difluoropiperidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 172887592 |
| Molecular Formula | C16H16ClF3N2O2 |
| Molecular Weight | 360.76 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-[1-[2-(2-chloro-6-fluorophenyl)acetyl]-4,4-difluoropiperidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CN(C(=O)Cc2c(F)cccc2Cl)CCC1(F)F |
| InChI | InChI=1S/C16H16ClF3N2O2/c1-2-14(23)21-13-9-22(7-6-16(13,19)20)15(24)8-10-11(17)4-3-5-12(10)18/h2-5,13H,1,6-9H2,(H,21,23) |
| InChIKey | MIWYYTUATGZXER-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.76 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|