C15H16FN3O2 — CID 172890392
5-(5-fluoro-2-propan-2-yloxy-4-pyridinyl)-N-methylpyridine-2-carboxamide (PubChem CID 172890392) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 5-(5-fluoro-2-propan-2-yloxy-4-pyridinyl)-N-methylpyridine-2-carboxamide.
| Compound Name | 5-(5-fluoro-2-propan-2-yloxy-4-pyridinyl)-N-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 172890392 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 5-(5-fluoro-2-propan-2-yloxy-4-pyridinyl)-N-methylpyridine-2-carboxamide |
| SMILES | CNC(=O)c1ccc(-c2cc(OC(C)C)ncc2F)cn1 |
| InChI | InChI=1S/C15H16FN3O2/c1-9(2)21-14-6-11(12(16)8-19-14)10-4-5-13(18-7-10)15(20)17-3/h4-9H,1-3H3,(H,17,20) |
| InChIKey | UPNUQNNSXNVEJR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |