About 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide
1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 172890629) has the molecular formula C14H14FN3O2
and a molecular weight of 275.28 g/mol. Its IUPAC name is 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide.
Molecular Properties
| Compound Name | 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide |
| PubChem CID | 172890629 |
| Molecular Formula | C14H14FN3O2 |
| Molecular Weight | 275.28 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | CCc1nnc(C2(C(=O)Nc3ccc(F)cc3)CC2)o1 |
| InChI | InChI=1S/C14H14FN3O2/c1-2-11-17-18-13(20-11)14(7-8-14)12(19)16-10-5-3-9(15)4-6-10/h3-6H,2,7-8H2,1H3,(H,16,19) |
| InChIKey | TXZPYYGTRWOBMS-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.28 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide?
The IUPAC name of 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide (CID 172890629) is 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide.
What is the SMILES notation for 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide?
The canonical SMILES for 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide is CCc1nnc(C2(C(=O)Nc3ccc(F)cc3)CC2)o1.
What is the InChIKey of 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide?
The InChIKey is TXZPYYGTRWOBMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14FN3O2/c1-2-11-17-18-13(20-11)14(7-8-14)12(19)16-10-5-3-9(15)4-6-10/h3-6H,2,7-8H2,1H3,(H,16,19).
What are the key properties of 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide?
1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide has a molecular weight of 275.28 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-ethyl-1,3,4-oxadiazol-2-yl)-N-(4-fluorophenyl)cyclopropane-1-carboxamide is sourced from PubChem (CID 172890629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).