C15H18N2O2 — CID 172892790
2,7-dimethyl-1-oxo-N-propylisoquinoline-3-carboxamide (PubChem CID 172892790) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,7-dimethyl-1-oxo-N-propylisoquinoline-3-carboxamide.
| Compound Name | 2,7-dimethyl-1-oxo-N-propylisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 172892790 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2,7-dimethyl-1-oxo-N-propylisoquinoline-3-carboxamide |
| SMILES | CCCNC(=O)c1cc2ccc(C)cc2c(=O)n1C |
| InChI | InChI=1S/C15H18N2O2/c1-4-7-16-14(18)13-9-11-6-5-10(2)8-12(11)15(19)17(13)3/h5-6,8-9H,4,7H2,1-3H3,(H,16,18) |
| InChIKey | RVAOKGINPGDCKK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |