C21H22F3N5 — CID 172893299
N-methyl-N-[1-(quinolin-4-ylmethyl)piperidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 172893299) has the molecular formula C21H22F3N5 and a molecular weight of 401.44 g/mol. Its IUPAC name is N-methyl-N-[1-(quinolin-4-ylmethyl)piperidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | N-methyl-N-[1-(quinolin-4-ylmethyl)piperidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 172893299 |
| Molecular Formula | C21H22F3N5 |
| Molecular Weight | 401.44 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-methyl-N-[1-(quinolin-4-ylmethyl)piperidin-3-yl]-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | CN(c1cc(C(F)(F)F)ncn1)C1CCCN(Cc2ccnc3ccccc23)C1 |
| InChI | InChI=1S/C21H22F3N5/c1-28(20-11-19(21(22,23)24)26-14-27-20)16-5-4-10-29(13-16)12-15-8-9-25-18-7-3-2-6-17(15)18/h2-3,6-9,11,14,16H,4-5,10,12-13H2,1H3 |
| InChIKey | GTLITWZCESIHHJ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |