C17H18N4O2 — CID 172893807
7-(3,5-dimethylphenyl)-2-(2-methylprop-2-enyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione (PubChem CID 172893807) has the molecular formula C17H18N4O2 and a molecular weight of 310.36 g/mol. Its IUPAC name is 7-(3,5-dimethylphenyl)-2-(2-methylprop-2-enyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione.
| Compound Name | 7-(3,5-dimethylphenyl)-2-(2-methylprop-2-enyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
|---|---|
| PubChem CID | 172893807 |
| Molecular Formula | C17H18N4O2 |
| Molecular Weight | 310.36 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 7-(3,5-dimethylphenyl)-2-(2-methylprop-2-enyl)-[1,2,4]triazolo[4,3-a]pyrazine-3,8-dione |
| SMILES | C=C(C)Cn1nc2c(=O)n(-c3cc(C)cc(C)c3)ccn2c1=O |
| InChI | InChI=1S/C17H18N4O2/c1-11(2)10-21-17(23)20-6-5-19(16(22)15(20)18-21)14-8-12(3)7-13(4)9-14/h5-9H,1,10H2,2-4H3 |
| InChIKey | TXRWQPBUGBWYBM-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.36 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|