C14H12F3N3O3 — CID 172893896
2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]-N-phenylacetamide (PubChem CID 172893896) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]-N-phenylacetamide.
| Compound Name | 2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]-N-phenylacetamide |
|---|---|
| PubChem CID | 172893896 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 2-[2,3-dioxo-4-(2,2,2-trifluoroethyl)pyrazin-1-yl]-N-phenylacetamide |
| SMILES | O=C(Cn1ccn(CC(F)(F)F)c(=O)c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C14H12F3N3O3/c15-14(16,17)9-20-7-6-19(12(22)13(20)23)8-11(21)18-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,18,21) |
| InChIKey | YJLXFJOKBUTNKE-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|