C23H28ClN3O4 — CID 172896355
N-[5-[2-(4-chlorophenyl)ethylcarbamoyl]-2-methylphenyl]-1-methylpyrrolidine-3-carboxamide;formic acid (PubChem CID 172896355) has the molecular formula C23H28ClN3O4 and a molecular weight of 445.95 g/mol. Its IUPAC name is N-[5-[2-(4-chlorophenyl)ethylcarbamoyl]-2-methylphenyl]-1-methylpyrrolidine-3-carboxamide;formic acid.
| Compound Name | N-[5-[2-(4-chlorophenyl)ethylcarbamoyl]-2-methylphenyl]-1-methylpyrrolidine-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 172896355 |
| Molecular Formula | C23H28ClN3O4 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[5-[2-(4-chlorophenyl)ethylcarbamoyl]-2-methylphenyl]-1-methylpyrrolidine-3-carboxamide;formic acid |
| SMILES | Cc1ccc(C(=O)NCCc2ccc(Cl)cc2)cc1NC(=O)C1CCN(C)C1.O=CO |
| InChI | InChI=1S/C22H26ClN3O2.CH2O2/c1-15-3-6-17(13-20(15)25-22(28)18-10-12-26(2)14-18)21(27)24-11-9-16-4-7-19(23)8-5-16;2-1-3/h3-8,13,18H,9-12,14H2,1-2H3,(H,24,27)(H,25,28);1H,(H,2,3) |
| InChIKey | KCOHCHXNWAPISM-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|