C27H32N2O5 — CID 172896622
formic acid;3-hydroxy-N-[(3R,4S)-3-hydroxy-1-(2-naphthalen-1-ylethyl)-4-phenylpiperidin-4-yl]propanamide (PubChem CID 172896622) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is formic acid;3-hydroxy-N-[(3R,4S)-3-hydroxy-1-(2-naphthalen-1-ylethyl)-4-phenylpiperidin-4-yl]propanamide.
| Compound Name | formic acid;3-hydroxy-N-[(3R,4S)-3-hydroxy-1-(2-naphthalen-1-ylethyl)-4-phenylpiperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 172896622 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | formic acid;3-hydroxy-N-[(3R,4S)-3-hydroxy-1-(2-naphthalen-1-ylethyl)-4-phenylpiperidin-4-yl]propanamide |
| SMILES | O=C(CCO)N[C@]1(c2ccccc2)CCN(CCc2cccc3ccccc23)C[C@H]1O.O=CO |
| InChI | InChI=1S/C26H30N2O3.CH2O2/c29-18-14-25(31)27-26(22-10-2-1-3-11-22)15-17-28(19-24(26)30)16-13-21-9-6-8-20-7-4-5-12-23(20)21;2-1-3/h1-12,24,29-30H,13-19H2,(H,27,31);1H,(H,2,3)/t24-,26+;/m1./s1 |
| InChIKey | MMVSJCWPIQNTBJ-OTTABGKNSA-N |
| XLogP | 2.54 |
| TPSA | 110.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|