C20H29ClN4O3 — CID 172896968
1-[2-(4-chloro-2-methylphenoxy)ethyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine;formic acid (PubChem CID 172896968) has the molecular formula C20H29ClN4O3 and a molecular weight of 408.93 g/mol. Its IUPAC name is 1-[2-(4-chloro-2-methylphenoxy)ethyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine;formic acid.
| Compound Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine;formic acid |
|---|---|
| PubChem CID | 172896968 |
| Molecular Formula | C20H29ClN4O3 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 1-[2-(4-chloro-2-methylphenoxy)ethyl]-4-[2-(2-methylimidazol-1-yl)ethyl]piperazine;formic acid |
| SMILES | Cc1cc(Cl)ccc1OCCN1CCN(CCn2ccnc2C)CC1.O=CO |
| InChI | InChI=1S/C19H27ClN4O.CH2O2/c1-16-15-18(20)3-4-19(16)25-14-13-23-9-7-22(8-10-23)11-12-24-6-5-21-17(24)2;2-1-3/h3-6,15H,7-14H2,1-2H3;1H,(H,2,3) |
| InChIKey | WBBZUUCADSZFMX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|