C21H27N3O4 — CID 172897401
2-[4-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]phenyl]-5-propyl-1H-pyrazol-3-one (PubChem CID 172897401) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 2-[4-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]phenyl]-5-propyl-1H-pyrazol-3-one.
| Compound Name | 2-[4-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]phenyl]-5-propyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 172897401 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 2-[4-[(4aS,6R,7aS)-6-(hydroxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carbonyl]phenyl]-5-propyl-1H-pyrazol-3-one |
| SMILES | CCCc1cc(=O)n(-c2ccc(C(=O)N3CCO[C@H]4C[C@H](CO)C[C@@H]43)cc2)[nH]1 |
| InChI | InChI=1S/C21H27N3O4/c1-2-3-16-12-20(26)24(22-16)17-6-4-15(5-7-17)21(27)23-8-9-28-19-11-14(13-25)10-18(19)23/h4-7,12,14,18-19,22,25H,2-3,8-11,13H2,1H3/t14-,18+,19+/m1/s1 |
| InChIKey | KMMMHYYBXROZBM-CCKFTAQKSA-N |
| XLogP | 1.73 |
| TPSA | 87.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |