C19H17FN4O6S3 — CID 172898460
2-(4-fluorophenyl)-5-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,3-thiazole (PubChem CID 172898460) has the molecular formula C19H17FN4O6S3 and a molecular weight of 512.57 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-5-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,3-thiazole.
| Compound Name | 2-(4-fluorophenyl)-5-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,3-thiazole |
|---|---|
| PubChem CID | 172898460 |
| Molecular Formula | C19H17FN4O6S3 |
| Molecular Weight | 512.57 g/mol |
| Exact Mass | 512.03 |
| IUPAC Name | 2-(4-fluorophenyl)-5-[4-(4-nitrophenyl)sulfonylpiperazin-1-yl]sulfonyl-1,3-thiazole |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CCN(S(=O)(=O)c3cnc(-c4ccc(F)cc4)s3)CC2)cc1 |
| InChI | InChI=1S/C19H17FN4O6S3/c20-15-3-1-14(2-4-15)19-21-13-18(31-19)33(29,30)23-11-9-22(10-12-23)32(27,28)17-7-5-16(6-8-17)24(25)26/h1-8,13H,9-12H2 |
| InChIKey | ZTWGSUKCAQAHOB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.57 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|