C11H17N3O3 — CID 172899427
4,6-dimethoxy-N-methyl-N-(oxolan-3-yl)pyrimidin-2-amine (PubChem CID 172899427) has the molecular formula C11H17N3O3 and a molecular weight of 239.27 g/mol. Its IUPAC name is 4,6-dimethoxy-N-methyl-N-(oxolan-3-yl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-methyl-N-(oxolan-3-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172899427 |
| Molecular Formula | C11H17N3O3 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 4,6-dimethoxy-N-methyl-N-(oxolan-3-yl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(N(C)C2CCOC2)n1 |
| InChI | InChI=1S/C11H17N3O3/c1-14(8-4-5-17-7-8)11-12-9(15-2)6-10(13-11)16-3/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | SQTJARYRXQWQAS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |