About N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine
N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 172899842) has the molecular formula C15H17F3N6
and a molecular weight of 338.34 g/mol. Its IUPAC name is N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
| PubChem CID | 172899842 |
| Molecular Formula | C15H17F3N6 |
| Molecular Weight | 338.34 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | Cc1ncnc(N2CC(N(C)c3cc(C(F)(F)F)ncn3)C2)c1C |
| InChI | InChI=1S/C15H17F3N6/c1-9-10(2)19-7-22-14(9)24-5-11(6-24)23(3)13-4-12(15(16,17)18)20-8-21-13/h4,7-8,11H,5-6H2,1-3H3 |
| InChIKey | GJRLTJQVLOVEMV-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.34 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine?
The IUPAC name of N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine (CID 172899842) is N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine.
What is the SMILES notation for N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine?
The canonical SMILES for N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine is Cc1ncnc(N2CC(N(C)c3cc(C(F)(F)F)ncn3)C2)c1C.
What is the InChIKey of N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine?
The InChIKey is GJRLTJQVLOVEMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17F3N6/c1-9-10(2)19-7-22-14(9)24-5-11(6-24)23(3)13-4-12(15(16,17)18)20-8-21-13/h4,7-8,11H,5-6H2,1-3H3.
What are the key properties of N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine?
N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine has a molecular weight of 338.34 g/mol, XLogP of 2.23, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(5,6-dimethylpyrimidin-4-yl)azetidin-3-yl]-N-methyl-6-(trifluoromethyl)pyrimidin-4-amine is sourced from PubChem (CID 172899842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).