C14H16FN5O — CID 172900126
[4-(3-fluoro-2-pyridinyl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 172900126) has the molecular formula C14H16FN5O and a molecular weight of 289.31 g/mol. Its IUPAC name is [4-(3-fluoro-2-pyridinyl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [4-(3-fluoro-2-pyridinyl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 172900126 |
| Molecular Formula | C14H16FN5O |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | [4-(3-fluoro-2-pyridinyl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cn1cc(C(=O)N2CCN(c3ncccc3F)CC2)cn1 |
| InChI | InChI=1S/C14H16FN5O/c1-18-10-11(9-17-18)14(21)20-7-5-19(6-8-20)13-12(15)3-2-4-16-13/h2-4,9-10H,5-8H2,1H3 |
| InChIKey | CNRVZEHTBBCMJA-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |