C18H20N6O — CID 172903220
[4-(4-methylphthalazin-1-yl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone (PubChem CID 172903220) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is [4-(4-methylphthalazin-1-yl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone.
| Compound Name | [4-(4-methylphthalazin-1-yl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 172903220 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | [4-(4-methylphthalazin-1-yl)piperazin-1-yl]-(1-methylpyrazol-4-yl)methanone |
| SMILES | Cc1nnc(N2CCN(C(=O)c3cnn(C)c3)CC2)c2ccccc12 |
| InChI | InChI=1S/C18H20N6O/c1-13-15-5-3-4-6-16(15)17(21-20-13)23-7-9-24(10-8-23)18(25)14-11-19-22(2)12-14/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | HKVZUISYDWLCOZ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |