C17H22FN7O — CID 172900137
N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 172900137) has the molecular formula C17H22FN7O and a molecular weight of 359.41 g/mol. Its IUPAC name is N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172900137 |
| Molecular Formula | C17H22FN7O |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-N-methyl-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | CN(c1ccnc(N2CCOCC2)n1)C1CCN(c2ncncc2F)C1 |
| InChI | InChI=1S/C17H22FN7O/c1-23(13-3-5-25(11-13)16-14(18)10-19-12-21-16)15-2-4-20-17(22-15)24-6-8-26-9-7-24/h2,4,10,12-13H,3,5-9,11H2,1H3 |
| InChIKey | NOFQSKTZVKLEEJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 70.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |