C16H20FN7O — CID 175648592
N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 175648592) has the molecular formula C16H20FN7O and a molecular weight of 345.38 g/mol. Its IUPAC name is N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 175648592 |
| Molecular Formula | C16H20FN7O |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | N-[1-(5-fluoropyrimidin-4-yl)pyrrolidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | Fc1cncnc1N1CCC(Nc2ccnc(N3CCOCC3)n2)C1 |
| InChI | InChI=1S/C16H20FN7O/c17-13-9-18-11-20-15(13)24-4-2-12(10-24)21-14-1-3-19-16(22-14)23-5-7-25-8-6-23/h1,3,9,11-12H,2,4-8,10H2,(H,19,21,22) |
| InChIKey | UGTZHUGYJVBMSR-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |