C18H25BrN2O2 — CID 172901337
2-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-1-morpholin-4-ylethanone (PubChem CID 172901337) has the molecular formula C18H25BrN2O2 and a molecular weight of 381.31 g/mol. Its IUPAC name is 2-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 172901337 |
| Molecular Formula | C18H25BrN2O2 |
| Molecular Weight | 381.31 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 2-[1-[(3-bromophenyl)methyl]piperidin-4-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(CC1CCN(Cc2cccc(Br)c2)CC1)N1CCOCC1 |
| InChI | InChI=1S/C18H25BrN2O2/c19-17-3-1-2-16(12-17)14-20-6-4-15(5-7-20)13-18(22)21-8-10-23-11-9-21/h1-3,12,15H,4-11,13-14H2 |
| InChIKey | LJXWUQSQGJRHIO-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |