C19H23BrN6 — CID 172902260
2-bromo-4-[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile (PubChem CID 172902260) has the molecular formula C19H23BrN6 and a molecular weight of 415.34 g/mol. Its IUPAC name is 2-bromo-4-[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile.
| Compound Name | 2-bromo-4-[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 172902260 |
| Molecular Formula | C19H23BrN6 |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | 2-bromo-4-[3-[[2-(dimethylamino)pyrimidin-4-yl]-methylamino]piperidin-1-yl]benzonitrile |
| SMILES | CN(C)c1nccc(N(C)C2CCCN(c3ccc(C#N)c(Br)c3)C2)n1 |
| InChI | InChI=1S/C19H23BrN6/c1-24(2)19-22-9-8-18(23-19)25(3)16-5-4-10-26(13-16)15-7-6-14(12-21)17(20)11-15/h6-9,11,16H,4-5,10,13H2,1-3H3 |
| InChIKey | ZGPMGADQGOPCGS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |