C18H24BrN5O2 — CID 172903179
N-[1-[(5-bromofuran-2-yl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 172903179) has the molecular formula C18H24BrN5O2 and a molecular weight of 422.33 g/mol. Its IUPAC name is N-[1-[(5-bromofuran-2-yl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[1-[(5-bromofuran-2-yl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172903179 |
| Molecular Formula | C18H24BrN5O2 |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | N-[1-[(5-bromofuran-2-yl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | Brc1ccc(CN2CCCC(Nc3ccnc(N4CCOCC4)n3)C2)o1 |
| InChI | InChI=1S/C18H24BrN5O2/c19-16-4-3-15(26-16)13-23-7-1-2-14(12-23)21-17-5-6-20-18(22-17)24-8-10-25-11-9-24/h3-6,14H,1-2,7-13H2,(H,20,21,22) |
| InChIKey | JCGFVGHKVDOLCD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 66.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |