C21H28ClN5O2 — CID 172903863
N-[1-[(2-chloro-3-methoxyphenyl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 172903863) has the molecular formula C21H28ClN5O2 and a molecular weight of 417.94 g/mol. Its IUPAC name is N-[1-[(2-chloro-3-methoxyphenyl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[1-[(2-chloro-3-methoxyphenyl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 172903863 |
| Molecular Formula | C21H28ClN5O2 |
| Molecular Weight | 417.94 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | N-[1-[(2-chloro-3-methoxyphenyl)methyl]piperidin-3-yl]-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | COc1cccc(CN2CCCC(Nc3ccnc(N4CCOCC4)n3)C2)c1Cl |
| InChI | InChI=1S/C21H28ClN5O2/c1-28-18-6-2-4-16(20(18)22)14-26-9-3-5-17(15-26)24-19-7-8-23-21(25-19)27-10-12-29-13-11-27/h2,4,6-8,17H,3,5,9-15H2,1H3,(H,23,24,25) |
| InChIKey | VMULBGYFTPUCBV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.94 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |