C18H24N6O2 — CID 172904111
2-N,2-N-dimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]pyrimidine-2,4-diamine (PubChem CID 172904111) has the molecular formula C18H24N6O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]pyrimidine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 172904111 |
| Molecular Formula | C18H24N6O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | 2-N,2-N-dimethyl-4-N-[1-[(4-nitrophenyl)methyl]piperidin-4-yl]pyrimidine-2,4-diamine |
| SMILES | CN(C)c1nccc(NC2CCN(Cc3ccc([N+](=O)[O-])cc3)CC2)n1 |
| InChI | InChI=1S/C18H24N6O2/c1-22(2)18-19-10-7-17(21-18)20-15-8-11-23(12-9-15)13-14-3-5-16(6-4-14)24(25)26/h3-7,10,15H,8-9,11-13H2,1-2H3,(H,19,20,21) |
| InChIKey | SVSFKOBZRBBDJT-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|