C18H21N5O2 — CID 172904212
2-cyclopropyl-N-[1-[(4-nitrophenyl)methyl]pyrrolidin-3-yl]pyrimidin-4-amine (PubChem CID 172904212) has the molecular formula C18H21N5O2 and a molecular weight of 339.40 g/mol. Its IUPAC name is 2-cyclopropyl-N-[1-[(4-nitrophenyl)methyl]pyrrolidin-3-yl]pyrimidin-4-amine.
| Compound Name | 2-cyclopropyl-N-[1-[(4-nitrophenyl)methyl]pyrrolidin-3-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 172904212 |
| Molecular Formula | C18H21N5O2 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 2-cyclopropyl-N-[1-[(4-nitrophenyl)methyl]pyrrolidin-3-yl]pyrimidin-4-amine |
| SMILES | O=[N+]([O-])c1ccc(CN2CCC(Nc3ccnc(C4CC4)n3)C2)cc1 |
| InChI | InChI=1S/C18H21N5O2/c24-23(25)16-5-1-13(2-6-16)11-22-10-8-15(12-22)20-17-7-9-19-18(21-17)14-3-4-14/h1-2,5-7,9,14-15H,3-4,8,10-12H2,(H,19,20,21) |
| InChIKey | OEGMDAQMIOVAOU-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|